C21H32N2O3 — CID 10247985
1-cyclohexyl-1-hydroxy-3-[4-(2-hydroxyethyl)piperazin-1-yl]-1-phenylpropan-2-one (PubChem CID 10247985) has the molecular formula C21H32N2O3 and a molecular weight of 360.50 g/mol. Its IUPAC name is 1-cyclohexyl-1-hydroxy-3-[4-(2-hydroxyethyl)piperazin-1-yl]-1-phenylpropan-2-one.
| Compound Name | 1-cyclohexyl-1-hydroxy-3-[4-(2-hydroxyethyl)piperazin-1-yl]-1-phenylpropan-2-one |
|---|---|
| PubChem CID | 10247985 |
| Molecular Formula | C21H32N2O3 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.24 |
| IUPAC Name | 1-cyclohexyl-1-hydroxy-3-[4-(2-hydroxyethyl)piperazin-1-yl]-1-phenylpropan-2-one |
| SMILES | O=C(CN1CCN(CCO)CC1)C(O)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C21H32N2O3/c24-16-15-22-11-13-23(14-12-22)17-20(25)21(26,18-7-3-1-4-8-18)19-9-5-2-6-10-19/h1,3-4,7-8,19,24,26H,2,5-6,9-17H2 |
| InChIKey | BOLUSSBWZNZYLY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |