C19H28N2O2 — CID 11623842
1-cyclopentyl-3-(1,4-diazepan-1-yl)-1-hydroxy-1-phenylpropan-2-one (PubChem CID 11623842) has the molecular formula C19H28N2O2 and a molecular weight of 316.44 g/mol. Its IUPAC name is 1-cyclopentyl-3-(1,4-diazepan-1-yl)-1-hydroxy-1-phenylpropan-2-one.
| Compound Name | 1-cyclopentyl-3-(1,4-diazepan-1-yl)-1-hydroxy-1-phenylpropan-2-one |
|---|---|
| PubChem CID | 11623842 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 1-cyclopentyl-3-(1,4-diazepan-1-yl)-1-hydroxy-1-phenylpropan-2-one |
| SMILES | O=C(CN1CCCNCC1)C(O)(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C19H28N2O2/c22-18(15-21-13-6-11-20-12-14-21)19(23,17-9-4-5-10-17)16-7-2-1-3-8-16/h1-3,7-8,17,20,23H,4-6,9-15H2 |
| InChIKey | DSGFPMYUGOOLHA-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |