C19H30ClNO2 — CID 10088596
(4-cyclopentyl-4-hydroxy-3-oxo-4-phenylbutyl)-ethyl-dimethylazanium chloride (PubChem CID 10088596) has the molecular formula C19H30ClNO2 and a molecular weight of 339.91 g/mol. Its IUPAC name is (4-cyclopentyl-4-hydroxy-3-oxo-4-phenylbutyl)-ethyl-dimethylazanium chloride.
| Compound Name | (4-cyclopentyl-4-hydroxy-3-oxo-4-phenylbutyl)-ethyl-dimethylazanium chloride |
|---|---|
| PubChem CID | 10088596 |
| Molecular Formula | C19H30ClNO2 |
| Molecular Weight | 339.91 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | (4-cyclopentyl-4-hydroxy-3-oxo-4-phenylbutyl)-ethyl-dimethylazanium chloride |
| SMILES | CC[N+](C)(C)CCC(=O)C(O)(c1ccccc1)C1CCCC1.[Cl-] |
| InChI | InChI=1S/C19H30NO2.ClH/c1-4-20(2,3)15-14-18(21)19(22,17-12-8-9-13-17)16-10-6-5-7-11-16;/h5-7,10-11,17,22H,4,8-9,12-15H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | FXUUNQXZPSSCSE-UHFFFAOYSA-M |
| XLogP | 0.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.91 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|