C20H27N2O+ — CID 8277
View drug profile → ambutonium(4-amino-4-oxo-3,3-diphenylbutyl)-ethyl-dimethylazanium (PubChem CID 8277) has the molecular formula C20H27N2O+ and a molecular weight of 311.45 g/mol. Its IUPAC name is (4-amino-4-oxo-3,3-diphenylbutyl)-ethyl-dimethylazanium.
| Compound Name | (4-amino-4-oxo-3,3-diphenylbutyl)-ethyl-dimethylazanium |
|---|---|
| PubChem CID | 8277 |
| Molecular Formula | C20H27N2O+ |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | (4-amino-4-oxo-3,3-diphenylbutyl)-ethyl-dimethylazanium |
| SMILES | CC[N+](C)(C)CCC(C(N)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H26N2O/c1-4-22(2,3)16-15-20(19(21)23,17-11-7-5-8-12-17)18-13-9-6-10-14-18/h5-14H,4,15-16H2,1-3H3,(H-,21,23)/p+1 |
| InChIKey | KFZMXOLSYABOSE-UHFFFAOYSA-O |
| XLogP | 2.94 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|