C23H31N2O+ — CID 3031584
2,2-diphenyl-4-(1,2,5-trimethylpyrrolidin-1-ium-1-yl)butanamide (PubChem CID 3031584) has the molecular formula C23H31N2O+ and a molecular weight of 351.51 g/mol. Its IUPAC name is 2,2-diphenyl-4-(1,2,5-trimethylpyrrolidin-1-ium-1-yl)butanamide.
| Compound Name | 2,2-diphenyl-4-(1,2,5-trimethylpyrrolidin-1-ium-1-yl)butanamide |
|---|---|
| PubChem CID | 3031584 |
| Molecular Formula | C23H31N2O+ |
| Molecular Weight | 351.51 g/mol |
| Exact Mass | 351.24 |
| IUPAC Name | 2,2-diphenyl-4-(1,2,5-trimethylpyrrolidin-1-ium-1-yl)butanamide |
| SMILES | CC1CCC(C)[N+]1(C)CCC(C(N)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H30N2O/c1-18-14-15-19(2)25(18,3)17-16-23(22(24)26,20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-13,18-19H,14-17H2,1-3H3,(H-,24,26)/p+1 |
| InChIKey | SZTONHWCWMFMBN-UHFFFAOYSA-O |
| XLogP | 3.87 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.51 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|