C24H33N2O+ — CID 92525899
2,2-diphenyl-4-[(2S,6R)-1,2,6-trimethylpiperidin-1-ium-1-yl]butanamide (PubChem CID 92525899) has the molecular formula C24H33N2O+ and a molecular weight of 365.54 g/mol. Its IUPAC name is 2,2-diphenyl-4-[(2S,6R)-1,2,6-trimethylpiperidin-1-ium-1-yl]butanamide.
| Compound Name | 2,2-diphenyl-4-[(2S,6R)-1,2,6-trimethylpiperidin-1-ium-1-yl]butanamide |
|---|---|
| PubChem CID | 92525899 |
| Molecular Formula | C24H33N2O+ |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | 2,2-diphenyl-4-[(2S,6R)-1,2,6-trimethylpiperidin-1-ium-1-yl]butanamide |
| SMILES | C[C@@H]1CCC[C@H](C)[N+]1(C)CCC(C(N)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H32N2O/c1-19-11-10-12-20(2)26(19,3)18-17-24(23(25)27,21-13-6-4-7-14-21)22-15-8-5-9-16-22/h4-9,13-16,19-20H,10-12,17-18H2,1-3H3,(H-,25,27)/p+1/t19-,20+,26? |
| InChIKey | WUXYHGRAKMMVOK-NJEHHLDASA-O |
| XLogP | 4.26 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|