C22H29IN2O — CID 3088093
4-(1-methylpiperidin-1-ium-1-yl)-2,2-diphenylbutanamide iodide (PubChem CID 3088093) has the molecular formula C22H29IN2O and a molecular weight of 464.39 g/mol. Its IUPAC name is 4-(1-methylpiperidin-1-ium-1-yl)-2,2-diphenylbutanamide iodide.
| Compound Name | 4-(1-methylpiperidin-1-ium-1-yl)-2,2-diphenylbutanamide iodide |
|---|---|
| PubChem CID | 3088093 |
| Molecular Formula | C22H29IN2O |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 464.13 |
| IUPAC Name | 4-(1-methylpiperidin-1-ium-1-yl)-2,2-diphenylbutanamide iodide |
| SMILES | C[N+]1(CCC(C(N)=O)(c2ccccc2)c2ccccc2)CCCCC1.[I-] |
| InChI | InChI=1S/C22H28N2O.HI/c1-24(16-9-4-10-17-24)18-15-22(21(23)25,19-11-5-2-6-12-19)20-13-7-3-8-14-20;/h2-3,5-8,11-14H,4,9-10,15-18H2,1H3,(H-,23,25);1H |
| InChIKey | YVQMYSACHYCCFB-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|