C20H29N2+ — CID 134105313
4-methyl-2-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]-2-phenylpent-3-enenitrile (PubChem CID 134105313) has the molecular formula C20H29N2+ and a molecular weight of 297.47 g/mol. Its IUPAC name is 4-methyl-2-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]-2-phenylpent-3-enenitrile.
| Compound Name | 4-methyl-2-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]-2-phenylpent-3-enenitrile |
|---|---|
| PubChem CID | 134105313 |
| Molecular Formula | C20H29N2+ |
| Molecular Weight | 297.47 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | 4-methyl-2-[2-(1-methylpiperidin-1-ium-1-yl)ethyl]-2-phenylpent-3-enenitrile |
| SMILES | CC(C)=CC(C#N)(CC[N+]1(C)CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C20H29N2/c1-18(2)16-20(17-21,19-10-6-4-7-11-19)12-15-22(3)13-8-5-9-14-22/h4,6-7,10-11,16H,5,8-9,12-15H2,1-3H3/q+1 |
| InChIKey | LADCNZNPCZQVPE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|