C19H32BrNO — CID 10619
5-methyl-1-(1-methylpiperidin-1-ium-1-yl)-4-phenylhexan-3-ol bromide (PubChem CID 10619) has the molecular formula C19H32BrNO and a molecular weight of 370.38 g/mol. Its IUPAC name is 5-methyl-1-(1-methylpiperidin-1-ium-1-yl)-4-phenylhexan-3-ol bromide.
| Compound Name | 5-methyl-1-(1-methylpiperidin-1-ium-1-yl)-4-phenylhexan-3-ol bromide |
|---|---|
| PubChem CID | 10619 |
| Molecular Formula | C19H32BrNO |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 5-methyl-1-(1-methylpiperidin-1-ium-1-yl)-4-phenylhexan-3-ol bromide |
| SMILES | CC(C)C(c1ccccc1)C(O)CC[N+]1(C)CCCCC1.[Br-] |
| InChI | InChI=1S/C19H32NO.BrH/c1-16(2)19(17-10-6-4-7-11-17)18(21)12-15-20(3)13-8-5-9-14-20;/h4,6-7,10-11,16,18-19,21H,5,8-9,12-15H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | CALMOSBYAPVNLT-UHFFFAOYSA-M |
| XLogP | 0.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|