C21H30NOSi+ — CID 12518949
hydroxy-[3-(1-methylpiperidin-1-ium-1-yl)propyl]-diphenylsilane (PubChem CID 12518949) has the molecular formula C21H30NOSi+ and a molecular weight of 340.56 g/mol. Its IUPAC name is hydroxy-[3-(1-methylpiperidin-1-ium-1-yl)propyl]-diphenylsilane.
| Compound Name | hydroxy-[3-(1-methylpiperidin-1-ium-1-yl)propyl]-diphenylsilane |
|---|---|
| PubChem CID | 12518949 |
| Molecular Formula | C21H30NOSi+ |
| Molecular Weight | 340.56 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | hydroxy-[3-(1-methylpiperidin-1-ium-1-yl)propyl]-diphenylsilane |
| SMILES | C[N+]1(CCC[Si](O)(c2ccccc2)c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C21H30NOSi/c1-22(16-9-4-10-17-22)18-11-19-24(23,20-12-5-2-6-13-20)21-14-7-3-8-15-21/h2-3,5-8,12-15,23H,4,9-11,16-19H2,1H3/q+1 |
| InChIKey | TXRNUDQULOWJKV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.56 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|