C22H38NOSi+ — CID 10051146
[cyclohexyl-[2-(1-methylazepan-1-ium-1-yl)ethyl]-phenylsilyl]methanol (PubChem CID 10051146) has the molecular formula C22H38NOSi+ and a molecular weight of 360.64 g/mol. Its IUPAC name is [cyclohexyl-[2-(1-methylazepan-1-ium-1-yl)ethyl]-phenylsilyl]methanol.
| Compound Name | [cyclohexyl-[2-(1-methylazepan-1-ium-1-yl)ethyl]-phenylsilyl]methanol |
|---|---|
| PubChem CID | 10051146 |
| Molecular Formula | C22H38NOSi+ |
| Molecular Weight | 360.64 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | [cyclohexyl-[2-(1-methylazepan-1-ium-1-yl)ethyl]-phenylsilyl]methanol |
| SMILES | C[N+]1(CC[Si@@](CO)(c2ccccc2)C2CCCCC2)CCCCCC1 |
| InChI | InChI=1S/C22H38NOSi/c1-23(16-10-2-3-11-17-23)18-19-25(20-24,21-12-6-4-7-13-21)22-14-8-5-9-15-22/h4,6-7,12-13,22,24H,2-3,5,8-11,14-20H2,1H3/q+1/t25-/m1/s1 |
| InChIKey | FESIPJBYGOCEKW-RUZDIDTESA-N |
| XLogP | 4.23 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.64 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|