C19H31NOSi — CID 10064439
[cyclohexyl-phenyl-(2-pyrrolidin-1-ylethyl)silyl]methanol (PubChem CID 10064439) has the molecular formula C19H31NOSi and a molecular weight of 317.55 g/mol. Its IUPAC name is [cyclohexyl-phenyl-(2-pyrrolidin-1-ylethyl)silyl]methanol.
| Compound Name | [cyclohexyl-phenyl-(2-pyrrolidin-1-ylethyl)silyl]methanol |
|---|---|
| PubChem CID | 10064439 |
| Molecular Formula | C19H31NOSi |
| Molecular Weight | 317.55 g/mol |
| Exact Mass | 317.22 |
| IUPAC Name | [cyclohexyl-phenyl-(2-pyrrolidin-1-ylethyl)silyl]methanol |
| SMILES | OC[Si@@](CCN1CCCC1)(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C19H31NOSi/c21-17-22(18-9-3-1-4-10-18,19-11-5-2-6-12-19)16-15-20-13-7-8-14-20/h1,3-4,9-10,19,21H,2,5-8,11-17H2/t22-/m0/s1 |
| InChIKey | NVISAUXILLGVTQ-QFIPXVFZSA-N |
| XLogP | 3.30 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.55 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|