C15H19NOSi — CID 164773913
3-[hydroxy(diphenyl)silyl]propan-1-amine (PubChem CID 164773913) has the molecular formula C15H19NOSi and a molecular weight of 257.41 g/mol. Its IUPAC name is 3-[hydroxy(diphenyl)silyl]propan-1-amine.
| Compound Name | 3-[hydroxy(diphenyl)silyl]propan-1-amine |
|---|---|
| PubChem CID | 164773913 |
| Molecular Formula | C15H19NOSi |
| Molecular Weight | 257.41 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 3-[hydroxy(diphenyl)silyl]propan-1-amine |
| SMILES | NCCC[Si](O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H19NOSi/c16-12-7-13-18(17,14-8-3-1-4-9-14)15-10-5-2-6-11-15/h1-6,8-11,17H,7,12-13,16H2 |
| InChIKey | IHGNJXYUTWVBSX-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.41 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|