About methanol;toluene;3-trimethoxysilylpropan-1-amine
methanol;toluene;3-trimethoxysilylpropan-1-amine (PubChem CID 174567080) has the molecular formula C14H29NO4Si
and a molecular weight of 303.48 g/mol. Its IUPAC name is methanol;toluene;3-trimethoxysilylpropan-1-amine.
Molecular Properties
| Compound Name | methanol;toluene;3-trimethoxysilylpropan-1-amine |
| PubChem CID | 174567080 |
| Molecular Formula | C14H29NO4Si |
| Molecular Weight | 303.48 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | methanol;toluene;3-trimethoxysilylpropan-1-amine |
| SMILES | CO.CO[Si](CCCN)(OC)OC.Cc1ccccc1 |
| InChI | InChI=1S/C7H8.C6H17NO3Si.CH4O/c1-7-5-3-2-4-6-7;1-8-11(9-2,10-3)6-4-5-7;1-2/h2-6H,1H3;4-7H2,1-3H3;2H,1H3 |
| InChIKey | XWEMWQZMQOFFNG-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 73.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.48 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methanol;toluene;3-trimethoxysilylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;toluene;3-trimethoxysilylpropan-1-amine?
The IUPAC name of methanol;toluene;3-trimethoxysilylpropan-1-amine (CID 174567080) is methanol;toluene;3-trimethoxysilylpropan-1-amine.
What is the SMILES notation for methanol;toluene;3-trimethoxysilylpropan-1-amine?
The canonical SMILES for methanol;toluene;3-trimethoxysilylpropan-1-amine is CO.CO[Si](CCCN)(OC)OC.Cc1ccccc1.
What is the InChIKey of methanol;toluene;3-trimethoxysilylpropan-1-amine?
The InChIKey is XWEMWQZMQOFFNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8.C6H17NO3Si.CH4O/c1-7-5-3-2-4-6-7;1-8-11(9-2,10-3)6-4-5-7;1-2/h2-6H,1H3;4-7H2,1-3H3;2H,1H3.
What are the key properties of methanol;toluene;3-trimethoxysilylpropan-1-amine?
methanol;toluene;3-trimethoxysilylpropan-1-amine has a molecular weight of 303.48 g/mol, XLogP of 1.82, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;toluene;3-trimethoxysilylpropan-1-amine is sourced from PubChem (CID 174567080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).