C12H21NO3Si — CID 66586388
3-[dimethoxy(phenylmethoxy)silyl]propan-1-amine (PubChem CID 66586388) has the molecular formula C12H21NO3Si and a molecular weight of 255.39 g/mol. Its IUPAC name is 3-[dimethoxy(phenylmethoxy)silyl]propan-1-amine.
| Compound Name | 3-[dimethoxy(phenylmethoxy)silyl]propan-1-amine |
|---|---|
| PubChem CID | 66586388 |
| Molecular Formula | C12H21NO3Si |
| Molecular Weight | 255.39 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 3-[dimethoxy(phenylmethoxy)silyl]propan-1-amine |
| SMILES | CO[Si](CCCN)(OC)OCc1ccccc1 |
| InChI | InChI=1S/C12H21NO3Si/c1-14-17(15-2,10-6-9-13)16-11-12-7-4-3-5-8-12/h3-5,7-8H,6,9-11,13H2,1-2H3 |
| InChIKey | OKWYEBJNFREPEV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.39 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|