C17H31ClN2O3Si — CID 140986490
1-[3-aminopropyl(dimethoxy)silyl]oxy-N-benzyl-N-ethenylpropan-2-amine;hydrochloride (PubChem CID 140986490) has the molecular formula C17H31ClN2O3Si and a molecular weight of 374.99 g/mol. Its IUPAC name is 1-[3-aminopropyl(dimethoxy)silyl]oxy-N-benzyl-N-ethenylpropan-2-amine;hydrochloride.
| Compound Name | 1-[3-aminopropyl(dimethoxy)silyl]oxy-N-benzyl-N-ethenylpropan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 140986490 |
| Molecular Formula | C17H31ClN2O3Si |
| Molecular Weight | 374.99 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 1-[3-aminopropyl(dimethoxy)silyl]oxy-N-benzyl-N-ethenylpropan-2-amine;hydrochloride |
| SMILES | C=CN(Cc1ccccc1)C(C)CO[Si](CCCN)(OC)OC.Cl |
| InChI | InChI=1S/C17H30N2O3Si.ClH/c1-5-19(14-17-10-7-6-8-11-17)16(2)15-22-23(20-3,21-4)13-9-12-18;/h5-8,10-11,16H,1,9,12-15,18H2,2-4H3;1H |
| InChIKey | BXFQJSVXDZXHCO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.99 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|