C23H43ClN2O3Si — CID 141259839
N'-benzyl-N'-ethenyl-N-[3-tri(propan-2-yloxy)silylpropyl]ethane-1,2-diamine;hydrochloride (PubChem CID 141259839) has the molecular formula C23H43ClN2O3Si and a molecular weight of 459.15 g/mol. Its IUPAC name is N'-benzyl-N'-ethenyl-N-[3-tri(propan-2-yloxy)silylpropyl]ethane-1,2-diamine;hydrochloride.
| Compound Name | N'-benzyl-N'-ethenyl-N-[3-tri(propan-2-yloxy)silylpropyl]ethane-1,2-diamine;hydrochloride |
|---|---|
| PubChem CID | 141259839 |
| Molecular Formula | C23H43ClN2O3Si |
| Molecular Weight | 459.15 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | N'-benzyl-N'-ethenyl-N-[3-tri(propan-2-yloxy)silylpropyl]ethane-1,2-diamine;hydrochloride |
| SMILES | C=CN(CCNCCC[Si](OC(C)C)(OC(C)C)OC(C)C)Cc1ccccc1.Cl |
| InChI | InChI=1S/C23H42N2O3Si.ClH/c1-8-25(19-23-13-10-9-11-14-23)17-16-24-15-12-18-29(26-20(2)3,27-21(4)5)28-22(6)7;/h8-11,13-14,20-22,24H,1,12,15-19H2,2-7H3;1H |
| InChIKey | ISHYPVOQXRYFRK-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.15 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|