C19H37ClN2O3Si — CID 19829630
N'-benzyl-N-(3-trimethoxysilylpropyl)hexane-1,6-diamine;hydrochloride (PubChem CID 19829630) has the molecular formula C19H37ClN2O3Si and a molecular weight of 405.06 g/mol. Its IUPAC name is N'-benzyl-N-(3-trimethoxysilylpropyl)hexane-1,6-diamine;hydrochloride.
| Compound Name | N'-benzyl-N-(3-trimethoxysilylpropyl)hexane-1,6-diamine;hydrochloride |
|---|---|
| PubChem CID | 19829630 |
| Molecular Formula | C19H37ClN2O3Si |
| Molecular Weight | 405.06 g/mol |
| Exact Mass | 404.23 |
| IUPAC Name | N'-benzyl-N-(3-trimethoxysilylpropyl)hexane-1,6-diamine;hydrochloride |
| SMILES | CO[Si](CCCNCCCCCCNCc1ccccc1)(OC)OC.Cl |
| InChI | InChI=1S/C19H36N2O3Si.ClH/c1-22-25(23-2,24-3)17-11-16-20-14-9-4-5-10-15-21-18-19-12-7-6-8-13-19;/h6-8,12-13,20-21H,4-5,9-11,14-18H2,1-3H3;1H |
| InChIKey | IEIQBBIQMRDTKF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.06 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|