C20H27NO4Si — CID 176549486
phenyl-[3-[(3-trimethoxysilylpropylamino)methyl]phenyl]methanone (PubChem CID 176549486) has the molecular formula C20H27NO4Si and a molecular weight of 373.53 g/mol. Its IUPAC name is phenyl-[3-[(3-trimethoxysilylpropylamino)methyl]phenyl]methanone.
| Compound Name | phenyl-[3-[(3-trimethoxysilylpropylamino)methyl]phenyl]methanone |
|---|---|
| PubChem CID | 176549486 |
| Molecular Formula | C20H27NO4Si |
| Molecular Weight | 373.53 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | phenyl-[3-[(3-trimethoxysilylpropylamino)methyl]phenyl]methanone |
| SMILES | CO[Si](CCCNCc1cccc(C(=O)c2ccccc2)c1)(OC)OC |
| InChI | InChI=1S/C20H27NO4Si/c1-23-26(24-2,25-3)14-8-13-21-16-17-9-7-12-19(15-17)20(22)18-10-5-4-6-11-18/h4-7,9-12,15,21H,8,13-14,16H2,1-3H3 |
| InChIKey | AAAGLMHSWOUYFW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.53 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|