C20H25NO5Si — CID 58554755
4-benzoyl-N-(3-trimethoxysilylpropyl)benzamide (PubChem CID 58554755) has the molecular formula C20H25NO5Si and a molecular weight of 387.51 g/mol. Its IUPAC name is 4-benzoyl-N-(3-trimethoxysilylpropyl)benzamide.
| Compound Name | 4-benzoyl-N-(3-trimethoxysilylpropyl)benzamide |
|---|---|
| PubChem CID | 58554755 |
| Molecular Formula | C20H25NO5Si |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | 4-benzoyl-N-(3-trimethoxysilylpropyl)benzamide |
| SMILES | CO[Si](CCCNC(=O)c1ccc(C(=O)c2ccccc2)cc1)(OC)OC |
| InChI | InChI=1S/C20H25NO5Si/c1-24-27(25-2,26-3)15-7-14-21-20(23)18-12-10-17(11-13-18)19(22)16-8-5-4-6-9-16/h4-6,8-13H,7,14-15H2,1-3H3,(H,21,23) |
| InChIKey | HUYVVCPLJXLJCJ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|