C16H27N3O4Si — CID 123877140
4-(propan-2-yldiazenyl)-N-(3-trimethoxysilylpropyl)benzamide (PubChem CID 123877140) has the molecular formula C16H27N3O4Si and a molecular weight of 353.50 g/mol. Its IUPAC name is 4-(propan-2-yldiazenyl)-N-(3-trimethoxysilylpropyl)benzamide.
| Compound Name | 4-(propan-2-yldiazenyl)-N-(3-trimethoxysilylpropyl)benzamide |
|---|---|
| PubChem CID | 123877140 |
| Molecular Formula | C16H27N3O4Si |
| Molecular Weight | 353.50 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 4-(propan-2-yldiazenyl)-N-(3-trimethoxysilylpropyl)benzamide |
| SMILES | CO[Si](CCCNC(=O)c1ccc(/N=N/C(C)C)cc1)(OC)OC |
| InChI | InChI=1S/C16H27N3O4Si/c1-13(2)18-19-15-9-7-14(8-10-15)16(20)17-11-6-12-24(21-3,22-4)23-5/h7-10,13H,6,11-12H2,1-5H3,(H,17,20)/b19-18+ |
| InChIKey | NIHPTPZGXLFZCS-VHEBQXMUSA-N |
| XLogP | 3.18 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.50 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|