C24H36N4O4Si — CID 91272770
4-[[4-(dimethylamino)phenyl]diazenyl]-N-(3-triethoxysilylpropyl)benzamide (PubChem CID 91272770) has the molecular formula C24H36N4O4Si and a molecular weight of 472.66 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)phenyl]diazenyl]-N-(3-triethoxysilylpropyl)benzamide.
| Compound Name | 4-[[4-(dimethylamino)phenyl]diazenyl]-N-(3-triethoxysilylpropyl)benzamide |
|---|---|
| PubChem CID | 91272770 |
| Molecular Formula | C24H36N4O4Si |
| Molecular Weight | 472.66 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | 4-[[4-(dimethylamino)phenyl]diazenyl]-N-(3-triethoxysilylpropyl)benzamide |
| SMILES | CCO[Si](CCCNC(=O)c1ccc(/N=N/c2ccc(N(C)C)cc2)cc1)(OCC)OCC |
| InChI | InChI=1S/C24H36N4O4Si/c1-6-30-33(31-7-2,32-8-3)19-9-18-25-24(29)20-10-12-21(13-11-20)26-27-22-14-16-23(17-15-22)28(4)5/h10-17H,6-9,18-19H2,1-5H3,(H,25,29)/b27-26+ |
| InChIKey | VOPVQXKFKBVVBH-CYYJNZCTSA-N |
| XLogP | 5.34 |
| TPSA | 84.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.66 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|