C26H40N2O7Si — CID 175092573
N,N-dimethylaniline;4-(3-triethoxysilylpropylcarbamoyloxymethyl)benzoic acid (PubChem CID 175092573) has the molecular formula C26H40N2O7Si and a molecular weight of 520.70 g/mol. Its IUPAC name is N,N-dimethylaniline;4-(3-triethoxysilylpropylcarbamoyloxymethyl)benzoic acid.
| Compound Name | N,N-dimethylaniline;4-(3-triethoxysilylpropylcarbamoyloxymethyl)benzoic acid |
|---|---|
| PubChem CID | 175092573 |
| Molecular Formula | C26H40N2O7Si |
| Molecular Weight | 520.70 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | N,N-dimethylaniline;4-(3-triethoxysilylpropylcarbamoyloxymethyl)benzoic acid |
| SMILES | CCO[Si](CCCNC(=O)OCc1ccc(C(=O)O)cc1)(OCC)OCC.CN(C)c1ccccc1 |
| InChI | InChI=1S/C18H29NO7Si.C8H11N/c1-4-24-27(25-5-2,26-6-3)13-7-12-19-18(22)23-14-15-8-10-16(11-9-15)17(20)21;1-9(2)8-6-4-3-5-7-8/h8-11H,4-7,12-14H2,1-3H3,(H,19,22)(H,20,21);3-7H,1-2H3 |
| InChIKey | QINPLCSKZYEFQY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.70 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|