C17H24N2O6 — CID 91603559
4-[[4-(2-hydroxy-2-methylpropanoyl)phenyl]methoxycarbonylamino]butylcarbamic acid (PubChem CID 91603559) has the molecular formula C17H24N2O6 and a molecular weight of 352.39 g/mol. Its IUPAC name is 4-[[4-(2-hydroxy-2-methylpropanoyl)phenyl]methoxycarbonylamino]butylcarbamic acid.
| Compound Name | 4-[[4-(2-hydroxy-2-methylpropanoyl)phenyl]methoxycarbonylamino]butylcarbamic acid |
|---|---|
| PubChem CID | 91603559 |
| Molecular Formula | C17H24N2O6 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 4-[[4-(2-hydroxy-2-methylpropanoyl)phenyl]methoxycarbonylamino]butylcarbamic acid |
| SMILES | CC(C)(O)C(=O)c1ccc(COC(=O)NCCCCNC(=O)O)cc1 |
| InChI | InChI=1S/C17H24N2O6/c1-17(2,24)14(20)13-7-5-12(6-8-13)11-25-16(23)19-10-4-3-9-18-15(21)22/h5-8,18,24H,3-4,9-11H2,1-2H3,(H,19,23)(H,21,22) |
| InChIKey | CPXJRSUGGTZUEP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|