C13H16O4 — CID 68741075
[4-(2-hydroxy-2-methylpropanoyl)phenyl]methyl acetate (PubChem CID 68741075) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is [4-(2-hydroxy-2-methylpropanoyl)phenyl]methyl acetate.
| Compound Name | [4-(2-hydroxy-2-methylpropanoyl)phenyl]methyl acetate |
|---|---|
| PubChem CID | 68741075 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | [4-(2-hydroxy-2-methylpropanoyl)phenyl]methyl acetate |
| SMILES | CC(=O)OCc1ccc(C(=O)C(C)(C)O)cc1 |
| InChI | InChI=1S/C13H16O4/c1-9(14)17-8-10-4-6-11(7-5-10)12(15)13(2,3)16/h4-7,16H,8H2,1-3H3 |
| InChIKey | ZWYPLSWJYBYHIY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |