C18H20O2 — CID 164767991
2-hydroxy-2-methyl-1-[4-[(4-methylphenyl)methyl]phenyl]propan-1-one (PubChem CID 164767991) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-1-[4-[(4-methylphenyl)methyl]phenyl]propan-1-one.
| Compound Name | 2-hydroxy-2-methyl-1-[4-[(4-methylphenyl)methyl]phenyl]propan-1-one |
|---|---|
| PubChem CID | 164767991 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 2-hydroxy-2-methyl-1-[4-[(4-methylphenyl)methyl]phenyl]propan-1-one |
| SMILES | Cc1ccc(Cc2ccc(C(=O)C(C)(C)O)cc2)cc1 |
| InChI | InChI=1S/C18H20O2/c1-13-4-6-14(7-5-13)12-15-8-10-16(11-9-15)17(19)18(2,3)20/h4-11,20H,12H2,1-3H3 |
| InChIKey | IIBFWQWOLONOEE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |