C21H24O4 — CID 68791945
3-hydroxy-1-[4-[[4-(2-hydroxy-2-methylpropanoyl)phenyl]methyl]phenyl]-2-methylpropan-1-one (PubChem CID 68791945) has the molecular formula C21H24O4 and a molecular weight of 340.42 g/mol. Its IUPAC name is 3-hydroxy-1-[4-[[4-(2-hydroxy-2-methylpropanoyl)phenyl]methyl]phenyl]-2-methylpropan-1-one.
| Compound Name | 3-hydroxy-1-[4-[[4-(2-hydroxy-2-methylpropanoyl)phenyl]methyl]phenyl]-2-methylpropan-1-one |
|---|---|
| PubChem CID | 68791945 |
| Molecular Formula | C21H24O4 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 3-hydroxy-1-[4-[[4-(2-hydroxy-2-methylpropanoyl)phenyl]methyl]phenyl]-2-methylpropan-1-one |
| SMILES | CC(CO)C(=O)c1ccc(Cc2ccc(C(=O)C(C)(C)O)cc2)cc1 |
| InChI | InChI=1S/C21H24O4/c1-14(13-22)19(23)17-8-4-15(5-9-17)12-16-6-10-18(11-7-16)20(24)21(2,3)25/h4-11,14,22,25H,12-13H2,1-3H3 |
| InChIKey | ICEOYVOHXINZPU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |