C35H52N6O10 — CID 91162551
6-[3-[6-[[4-(2-hydroxy-2-methylpropanoyl)phenyl]methoxycarbonylamino]hexyl]-5-(6-isocyanatohexyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexylcarbamic acid (PubChem CID 91162551) has the molecular formula C35H52N6O10 and a molecular weight of 716.83 g/mol. Its IUPAC name is 6-[3-[6-[[4-(2-hydroxy-2-methylpropanoyl)phenyl]methoxycarbonylamino]hexyl]-5-(6-isocyanatohexyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexylcarbamic acid.
| Compound Name | 6-[3-[6-[[4-(2-hydroxy-2-methylpropanoyl)phenyl]methoxycarbonylamino]hexyl]-5-(6-isocyanatohexyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexylcarbamic acid |
|---|---|
| PubChem CID | 91162551 |
| Molecular Formula | C35H52N6O10 |
| Molecular Weight | 716.83 g/mol |
| Exact Mass | 716.37 |
| IUPAC Name | 6-[3-[6-[[4-(2-hydroxy-2-methylpropanoyl)phenyl]methoxycarbonylamino]hexyl]-5-(6-isocyanatohexyl)-2,4,6-trioxo-1,3,5-triazinan-1-yl]hexylcarbamic acid |
| SMILES | CC(C)(O)C(=O)c1ccc(COC(=O)NCCCCCCn2c(=O)n(CCCCCCN=C=O)c(=O)n(CCCCCCNC(=O)O)c2=O)cc1 |
| InChI | InChI=1S/C35H52N6O10/c1-35(2,50)29(43)28-17-15-27(16-18-28)25-51-31(46)38-21-11-5-8-14-24-41-33(48)39(22-12-6-3-9-19-36-26-42)32(47)40(34(41)49)23-13-7-4-10-20-37-30(44)45/h15-18,37,50H,3-14,19-25H2,1-2H3,(H,38,46)(H,44,45) |
| InChIKey | LZOJNYRSUAUZJG-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 220.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.83 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|