C18H29NO7Si — CID 141473259
4-(3-triethoxysilylpropylcarbamoyloxymethyl)benzoic acid (PubChem CID 141473259) has the molecular formula C18H29NO7Si and a molecular weight of 399.52 g/mol. Its IUPAC name is 4-(3-triethoxysilylpropylcarbamoyloxymethyl)benzoic acid.
| Compound Name | 4-(3-triethoxysilylpropylcarbamoyloxymethyl)benzoic acid |
|---|---|
| PubChem CID | 141473259 |
| Molecular Formula | C18H29NO7Si |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 4-(3-triethoxysilylpropylcarbamoyloxymethyl)benzoic acid |
| SMILES | CCO[Si](CCCNC(=O)OCc1ccc(C(=O)O)cc1)(OCC)OCC |
| InChI | InChI=1S/C18H29NO7Si/c1-4-24-27(25-5-2,26-6-3)13-7-12-19-18(22)23-14-15-8-10-16(11-9-15)17(20)21/h8-11H,4-7,12-14H2,1-3H3,(H,19,22)(H,20,21) |
| InChIKey | URTBYGKLPIHINE-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|