C29H38N2O5Si — CID 20771518
[4-(N-phenylanilino)phenyl]methyl N-(3-triethoxysilylpropyl)carbamate (PubChem CID 20771518) has the molecular formula C29H38N2O5Si and a molecular weight of 522.72 g/mol. Its IUPAC name is [4-(N-phenylanilino)phenyl]methyl N-(3-triethoxysilylpropyl)carbamate.
| Compound Name | [4-(N-phenylanilino)phenyl]methyl N-(3-triethoxysilylpropyl)carbamate |
|---|---|
| PubChem CID | 20771518 |
| Molecular Formula | C29H38N2O5Si |
| Molecular Weight | 522.72 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | [4-(N-phenylanilino)phenyl]methyl N-(3-triethoxysilylpropyl)carbamate |
| SMILES | CCO[Si](CCCNC(=O)OCc1ccc(N(c2ccccc2)c2ccccc2)cc1)(OCC)OCC |
| InChI | InChI=1S/C29H38N2O5Si/c1-4-34-37(35-5-2,36-6-3)23-13-22-30-29(32)33-24-25-18-20-28(21-19-25)31(26-14-9-7-10-15-26)27-16-11-8-12-17-27/h7-12,14-21H,4-6,13,22-24H2,1-3H3,(H,30,32) |
| InChIKey | MAGHNRRGOMUJQQ-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.72 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|