C30H42N2O9Si — CID 23727642
dibenzyl (2S,4R)-4-(3-triethoxysilylpropylcarbamoyloxy)pyrrolidine-1,2-dicarboxylate (PubChem CID 23727642) has the molecular formula C30H42N2O9Si and a molecular weight of 602.76 g/mol. Its IUPAC name is dibenzyl (2S,4R)-4-(3-triethoxysilylpropylcarbamoyloxy)pyrrolidine-1,2-dicarboxylate.
| Compound Name | dibenzyl (2S,4R)-4-(3-triethoxysilylpropylcarbamoyloxy)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 23727642 |
| Molecular Formula | C30H42N2O9Si |
| Molecular Weight | 602.76 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | dibenzyl (2S,4R)-4-(3-triethoxysilylpropylcarbamoyloxy)pyrrolidine-1,2-dicarboxylate |
| SMILES | CCO[Si](CCCNC(=O)O[C@@H]1C[C@@H](C(=O)OCc2ccccc2)N(C(=O)OCc2ccccc2)C1)(OCC)OCC |
| InChI | InChI=1S/C30H42N2O9Si/c1-4-38-42(39-5-2,40-6-3)19-13-18-31-29(34)41-26-20-27(28(33)36-22-24-14-9-7-10-15-24)32(21-26)30(35)37-23-25-16-11-8-12-17-25/h7-12,14-17,26-27H,4-6,13,18-23H2,1-3H3,(H,31,34)/t26-,27+/m1/s1 |
| InChIKey | UJHWXWCVDUNWGN-SXOMAYOGSA-N |
| XLogP | 4.67 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.76 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|