C16H19NO5 — CID 123446649
1-O-benzyl 2-O-methyl 4-ethenoxypyrrolidine-1,2-dicarboxylate (PubChem CID 123446649) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl 4-ethenoxypyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl 4-ethenoxypyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 123446649 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 1-O-benzyl 2-O-methyl 4-ethenoxypyrrolidine-1,2-dicarboxylate |
| SMILES | C=COC1CC(C(=O)OC)N(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C16H19NO5/c1-3-21-13-9-14(15(18)20-2)17(10-13)16(19)22-11-12-7-5-4-6-8-12/h3-8,13-14H,1,9-11H2,2H3 |
| InChIKey | AVLISCPIVCNXLU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|