C16H21NO7S — CID 11749045
1-O-benzyl 2-O-methyl (2S,5S)-5-methylsulfonyloxypiperidine-1,2-dicarboxylate (PubChem CID 11749045) has the molecular formula C16H21NO7S and a molecular weight of 371.41 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl (2S,5S)-5-methylsulfonyloxypiperidine-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl (2S,5S)-5-methylsulfonyloxypiperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11749045 |
| Molecular Formula | C16H21NO7S |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.10 |
| IUPAC Name | 1-O-benzyl 2-O-methyl (2S,5S)-5-methylsulfonyloxypiperidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CC[C@H](OS(C)(=O)=O)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H21NO7S/c1-22-15(18)14-9-8-13(24-25(2,20)21)10-17(14)16(19)23-11-12-6-4-3-5-7-12/h3-7,13-14H,8-11H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | WTWXGQLIRODVAK-KBPBESRZSA-N |
| XLogP | 1.31 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|