C17H21NO5 — CID 86727789
1-O-benzyl 3-O-methyl (3R,6S)-6-acetylpiperidine-1,3-dicarboxylate (PubChem CID 86727789) has the molecular formula C17H21NO5 and a molecular weight of 319.36 g/mol. Its IUPAC name is 1-O-benzyl 3-O-methyl (3R,6S)-6-acetylpiperidine-1,3-dicarboxylate.
| Compound Name | 1-O-benzyl 3-O-methyl (3R,6S)-6-acetylpiperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 86727789 |
| Molecular Formula | C17H21NO5 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 1-O-benzyl 3-O-methyl (3R,6S)-6-acetylpiperidine-1,3-dicarboxylate |
| SMILES | COC(=O)[C@@H]1CC[C@@H](C(C)=O)N(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C17H21NO5/c1-12(19)15-9-8-14(16(20)22-2)10-18(15)17(21)23-11-13-6-4-3-5-7-13/h3-7,14-15H,8-11H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | NZIUUSRGULLSQC-CABCVRRESA-N |
| XLogP | 2.17 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |