C21H24N2O4 — CID 67767224
1-O-[(3-aminophenyl)methyl] 3-O-methyl 6-phenylpiperidine-1,3-dicarboxylate (PubChem CID 67767224) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is 1-O-[(3-aminophenyl)methyl] 3-O-methyl 6-phenylpiperidine-1,3-dicarboxylate.
| Compound Name | 1-O-[(3-aminophenyl)methyl] 3-O-methyl 6-phenylpiperidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 67767224 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 1-O-[(3-aminophenyl)methyl] 3-O-methyl 6-phenylpiperidine-1,3-dicarboxylate |
| SMILES | COC(=O)C1CCC(c2ccccc2)N(C(=O)OCc2cccc(N)c2)C1 |
| InChI | InChI=1S/C21H24N2O4/c1-26-20(24)17-10-11-19(16-7-3-2-4-8-16)23(13-17)21(25)27-14-15-6-5-9-18(22)12-15/h2-9,12,17,19H,10-11,13-14,22H2,1H3 |
| InChIKey | BVJCBHXNGUWAQG-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|