C18H20N2O2 — CID 84818132
benzyl 2-(3-aminophenyl)pyrrolidine-1-carboxylate (PubChem CID 84818132) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is benzyl 2-(3-aminophenyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl 2-(3-aminophenyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 84818132 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | benzyl 2-(3-aminophenyl)pyrrolidine-1-carboxylate |
| SMILES | Nc1cccc(C2CCCN2C(=O)OCc2ccccc2)c1 |
| InChI | InChI=1S/C18H20N2O2/c19-16-9-4-8-15(12-16)17-10-5-11-20(17)18(21)22-13-14-6-2-1-3-7-14/h1-4,6-9,12,17H,5,10-11,13,19H2 |
| InChIKey | GRCWAZKMDBTVCI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|