C17H18N2O2 — CID 14814122
benzyl (2S)-2-pyridin-2-ylpyrrolidine-1-carboxylate (PubChem CID 14814122) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is benzyl (2S)-2-pyridin-2-ylpyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S)-2-pyridin-2-ylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 14814122 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | benzyl (2S)-2-pyridin-2-ylpyrrolidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC[C@H]1c1ccccn1 |
| InChI | InChI=1S/C17H18N2O2/c20-17(21-13-14-7-2-1-3-8-14)19-12-6-10-16(19)15-9-4-5-11-18-15/h1-5,7-9,11,16H,6,10,12-13H2/t16-/m0/s1 |
| InChIKey | WWWLTEYQTLVRCC-INIZCTEOSA-N |
| XLogP | 3.56 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |