C25H27N2O2+ — CID 102054099
benzyl 2-(1-benzylpyridin-1-ium-3-yl)piperidine-1-carboxylate (PubChem CID 102054099) has the molecular formula C25H27N2O2+ and a molecular weight of 387.50 g/mol. Its IUPAC name is benzyl 2-(1-benzylpyridin-1-ium-3-yl)piperidine-1-carboxylate.
| Compound Name | benzyl 2-(1-benzylpyridin-1-ium-3-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 102054099 |
| Molecular Formula | C25H27N2O2+ |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | benzyl 2-(1-benzylpyridin-1-ium-3-yl)piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCCCC1c1ccc[n+](Cc2ccccc2)c1 |
| InChI | InChI=1S/C25H27N2O2/c28-25(29-20-22-12-5-2-6-13-22)27-17-8-7-15-24(27)23-14-9-16-26(19-23)18-21-10-3-1-4-11-21/h1-6,9-14,16,19,24H,7-8,15,17-18,20H2/q+1 |
| InChIKey | VGDBIMKYEILLAC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|