C18H20N2O2 — CID 59730574
benzyl (2S,3R)-3-amino-2-phenylpyrrolidine-1-carboxylate (PubChem CID 59730574) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is benzyl (2S,3R)-3-amino-2-phenylpyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S,3R)-3-amino-2-phenylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 59730574 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | benzyl (2S,3R)-3-amino-2-phenylpyrrolidine-1-carboxylate |
| SMILES | N[C@@H]1CCN(C(=O)OCc2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C18H20N2O2/c19-16-11-12-20(17(16)15-9-5-2-6-10-15)18(21)22-13-14-7-3-1-4-8-14/h1-10,16-17H,11-13,19H2/t16-,17+/m1/s1 |
| InChIKey | VSIGZGUKHCRXJW-SJORKVTESA-N |
| XLogP | 3.10 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |