C25H24N2O2 — CID 15418278
benzyl (3aS,9bS)-4-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carboxylate (PubChem CID 15418278) has the molecular formula C25H24N2O2 and a molecular weight of 384.48 g/mol. Its IUPAC name is benzyl (3aS,9bS)-4-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carboxylate.
| Compound Name | benzyl (3aS,9bS)-4-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carboxylate |
|---|---|
| PubChem CID | 15418278 |
| Molecular Formula | C25H24N2O2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | benzyl (3aS,9bS)-4-phenyl-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CC[C@H]2C(c3ccccc3)Nc3ccccc3[C@H]21 |
| InChI | InChI=1S/C25H24N2O2/c28-25(29-17-18-9-3-1-4-10-18)27-16-15-21-23(19-11-5-2-6-12-19)26-22-14-8-7-13-20(22)24(21)27/h1-14,21,23-24,26H,15-17H2/t21-,23?,24+/m0/s1 |
| InChIKey | MBDMLFMKRGCYIS-FYFGAKMPSA-N |
| XLogP | 5.55 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |