C25H23ClN2O2 — CID 154717770
benzyl (3aS,4R,9bS)-4-(3-chlorophenyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carboxylate (PubChem CID 154717770) has the molecular formula C25H23ClN2O2 and a molecular weight of 418.92 g/mol. Its IUPAC name is benzyl (3aS,4R,9bS)-4-(3-chlorophenyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carboxylate.
| Compound Name | benzyl (3aS,4R,9bS)-4-(3-chlorophenyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carboxylate |
|---|---|
| PubChem CID | 154717770 |
| Molecular Formula | C25H23ClN2O2 |
| Molecular Weight | 418.92 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | benzyl (3aS,4R,9bS)-4-(3-chlorophenyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CC[C@@H]2[C@H]1c1ccccc1N[C@H]2c1cccc(Cl)c1 |
| InChI | InChI=1S/C25H23ClN2O2/c26-19-10-6-9-18(15-19)23-21-13-14-28(24(21)20-11-4-5-12-22(20)27-23)25(29)30-16-17-7-2-1-3-8-17/h1-12,15,21,23-24,27H,13-14,16H2/t21-,23-,24+/m0/s1 |
| InChIKey | AHMQIAUEEYXQDW-OEMFJLHTSA-N |
| XLogP | 6.21 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.92 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |