C30H32N2O4 — CID 90040827
benzyl (4aR,5R,10bR)-5-(4-methoxycarbonyl-2-methylphenyl)-9-methyl-3,4,4a,5,6,10b-hexahydro-2H-benzo[h][1,6]naphthyridine-1-carboxylate (PubChem CID 90040827) has the molecular formula C30H32N2O4 and a molecular weight of 484.60 g/mol. Its IUPAC name is benzyl (4aR,5R,10bR)-5-(4-methoxycarbonyl-2-methylphenyl)-9-methyl-3,4,4a,5,6,10b-hexahydro-2H-benzo[h][1,6]naphthyridine-1-carboxylate.
| Compound Name | benzyl (4aR,5R,10bR)-5-(4-methoxycarbonyl-2-methylphenyl)-9-methyl-3,4,4a,5,6,10b-hexahydro-2H-benzo[h][1,6]naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 90040827 |
| Molecular Formula | C30H32N2O4 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.24 |
| IUPAC Name | benzyl (4aR,5R,10bR)-5-(4-methoxycarbonyl-2-methylphenyl)-9-methyl-3,4,4a,5,6,10b-hexahydro-2H-benzo[h][1,6]naphthyridine-1-carboxylate |
| SMILES | COC(=O)c1ccc([C@@H]2Nc3ccc(C)cc3[C@H]3[C@@H]2CCCN3C(=O)OCc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C30H32N2O4/c1-19-11-14-26-25(16-19)28-24(27(31-26)23-13-12-22(17-20(23)2)29(33)35-3)10-7-15-32(28)30(34)36-18-21-8-5-4-6-9-21/h4-6,8-9,11-14,16-17,24,27-28,31H,7,10,15,18H2,1-3H3/t24-,27+,28-/m1/s1 |
| InChIKey | AAVYEUKOOCXOBN-FQLPYIGMSA-N |
| XLogP | 6.35 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |