C18H20N2O2S — CID 102542696
benzyl 2-(4-methyl-6-sulfanylidene-1H-pyridin-3-yl)pyrrolidine-1-carboxylate (PubChem CID 102542696) has the molecular formula C18H20N2O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is benzyl 2-(4-methyl-6-sulfanylidene-1H-pyridin-3-yl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl 2-(4-methyl-6-sulfanylidene-1H-pyridin-3-yl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 102542696 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | benzyl 2-(4-methyl-6-sulfanylidene-1H-pyridin-3-yl)pyrrolidine-1-carboxylate |
| SMILES | Cc1cc(=S)[nH]cc1C1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H20N2O2S/c1-13-10-17(23)19-11-15(13)16-8-5-9-20(16)18(21)22-12-14-6-3-2-4-7-14/h2-4,6-7,10-11,16H,5,8-9,12H2,1H3,(H,19,23) |
| InChIKey | HEKMTBNBRXLRNQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|