C27H25Cl2N3O2S — CID 11752832
methyl (3aS,4R,9bS)-1-(benzylcarbamothioyl)-4-(3,4-dichlorophenyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-8-carboxylate (PubChem CID 11752832) has the molecular formula C27H25Cl2N3O2S and a molecular weight of 526.49 g/mol. Its IUPAC name is methyl (3aS,4R,9bS)-1-(benzylcarbamothioyl)-4-(3,4-dichlorophenyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-8-carboxylate.
| Compound Name | methyl (3aS,4R,9bS)-1-(benzylcarbamothioyl)-4-(3,4-dichlorophenyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-8-carboxylate |
|---|---|
| PubChem CID | 11752832 |
| Molecular Formula | C27H25Cl2N3O2S |
| Molecular Weight | 526.49 g/mol |
| Exact Mass | 525.10 |
| IUPAC Name | methyl (3aS,4R,9bS)-1-(benzylcarbamothioyl)-4-(3,4-dichlorophenyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-8-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)[C@@H]1[C@@H](CCN1C(=S)NCc1ccccc1)[C@H](c1ccc(Cl)c(Cl)c1)N2 |
| InChI | InChI=1S/C27H25Cl2N3O2S/c1-34-26(33)18-8-10-23-20(13-18)25-19(24(31-23)17-7-9-21(28)22(29)14-17)11-12-32(25)27(35)30-15-16-5-3-2-4-6-16/h2-10,13-14,19,24-25,31H,11-12,15H2,1H3,(H,30,35)/t19-,24-,25-/m0/s1 |
| InChIKey | NXNSJSVADOLMFB-LQGLAIQGSA-N |
| XLogP | 6.38 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.49 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|