C25H30N6O3 — CID 102453879
ethyl (3aR,4S,9bR)-4-(3-azidopropyl)-1-(benzylcarbamoyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-8-carboxylate (PubChem CID 102453879) has the molecular formula C25H30N6O3 and a molecular weight of 462.55 g/mol. Its IUPAC name is ethyl (3aR,4S,9bR)-4-(3-azidopropyl)-1-(benzylcarbamoyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-8-carboxylate.
| Compound Name | ethyl (3aR,4S,9bR)-4-(3-azidopropyl)-1-(benzylcarbamoyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-8-carboxylate |
|---|---|
| PubChem CID | 102453879 |
| Molecular Formula | C25H30N6O3 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | ethyl (3aR,4S,9bR)-4-(3-azidopropyl)-1-(benzylcarbamoyl)-2,3,3a,4,5,9b-hexahydropyrrolo[3,2-c]quinoline-8-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)[C@H]1[C@H](CCN1C(=O)NCc1ccccc1)[C@H](CCCN=[N+]=[N-])N2 |
| InChI | InChI=1S/C25H30N6O3/c1-2-34-24(32)18-10-11-22-20(15-18)23-19(21(29-22)9-6-13-28-30-26)12-14-31(23)25(33)27-16-17-7-4-3-5-8-17/h3-5,7-8,10-11,15,19,21,23,29H,2,6,9,12-14,16H2,1H3,(H,27,33)/t19-,21+,23-/m1/s1 |
| InChIKey | IKLGPJSXLUVSSK-UNWVZKJWSA-N |
| XLogP | 5.02 |
| TPSA | 119.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|