C22H28N2O2 — CID 71745064
ethyl 3-(benzylamino)-4-(cyclohexylamino)benzoate (PubChem CID 71745064) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is ethyl 3-(benzylamino)-4-(cyclohexylamino)benzoate.
| Compound Name | ethyl 3-(benzylamino)-4-(cyclohexylamino)benzoate |
|---|---|
| PubChem CID | 71745064 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | ethyl 3-(benzylamino)-4-(cyclohexylamino)benzoate |
| SMILES | CCOC(=O)c1ccc(NC2CCCCC2)c(NCc2ccccc2)c1 |
| InChI | InChI=1S/C22H28N2O2/c1-2-26-22(25)18-13-14-20(24-19-11-7-4-8-12-19)21(15-18)23-16-17-9-5-3-6-10-17/h3,5-6,9-10,13-15,19,23-24H,2,4,7-8,11-12,16H2,1H3 |
| InChIKey | VHQAJFNLPQULSV-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |