C20H26N2 — CID 178096856
2-N-benzyl-1-N-cyclohexyl-4-methylbenzene-1,2-diamine (PubChem CID 178096856) has the molecular formula C20H26N2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 2-N-benzyl-1-N-cyclohexyl-4-methylbenzene-1,2-diamine.
| Compound Name | 2-N-benzyl-1-N-cyclohexyl-4-methylbenzene-1,2-diamine |
|---|---|
| PubChem CID | 178096856 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 2-N-benzyl-1-N-cyclohexyl-4-methylbenzene-1,2-diamine |
| SMILES | Cc1ccc(NC2CCCCC2)c(NCc2ccccc2)c1 |
| InChI | InChI=1S/C20H26N2/c1-16-12-13-19(22-18-10-6-3-7-11-18)20(14-16)21-15-17-8-4-2-5-9-17/h2,4-5,8-9,12-14,18,21-22H,3,6-7,10-11,15H2,1H3 |
| InChIKey | MTQYWDADPKTFFF-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |