C19H26N4S — CID 146541556
1-N-cyclohexyl-4-(methylaminosulfanyl)-2-N-(pyridin-4-ylmethyl)benzene-1,2-diamine (PubChem CID 146541556) has the molecular formula C19H26N4S and a molecular weight of 342.51 g/mol. Its IUPAC name is 1-N-cyclohexyl-4-(methylaminosulfanyl)-2-N-(pyridin-4-ylmethyl)benzene-1,2-diamine.
| Compound Name | 1-N-cyclohexyl-4-(methylaminosulfanyl)-2-N-(pyridin-4-ylmethyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 146541556 |
| Molecular Formula | C19H26N4S |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 1-N-cyclohexyl-4-(methylaminosulfanyl)-2-N-(pyridin-4-ylmethyl)benzene-1,2-diamine |
| SMILES | CNSc1ccc(NC2CCCCC2)c(NCc2ccncc2)c1 |
| InChI | InChI=1S/C19H26N4S/c1-20-24-17-7-8-18(23-16-5-3-2-4-6-16)19(13-17)22-14-15-9-11-21-12-10-15/h7-13,16,20,22-23H,2-6,14H2,1H3 |
| InChIKey | PQZXGBJYPPQZDK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 48.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|