C24H38N8S — CID 142534944
N-amino-N-[[amino-[2-(cyclohexylamino)-5-(methylaminosulfanyl)phenyl]methyl]amino]-1-pyridin-3-ylpiperidin-3-amine (PubChem CID 142534944) has the molecular formula C24H38N8S and a molecular weight of 470.69 g/mol. Its IUPAC name is N-amino-N-[[amino-[2-(cyclohexylamino)-5-(methylaminosulfanyl)phenyl]methyl]amino]-1-pyridin-3-ylpiperidin-3-amine.
| Compound Name | N-amino-N-[[amino-[2-(cyclohexylamino)-5-(methylaminosulfanyl)phenyl]methyl]amino]-1-pyridin-3-ylpiperidin-3-amine |
|---|---|
| PubChem CID | 142534944 |
| Molecular Formula | C24H38N8S |
| Molecular Weight | 470.69 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | N-amino-N-[[amino-[2-(cyclohexylamino)-5-(methylaminosulfanyl)phenyl]methyl]amino]-1-pyridin-3-ylpiperidin-3-amine |
| SMILES | CNSc1ccc(NC2CCCCC2)c(C(N)NN(N)C2CCCN(c3cccnc3)C2)c1 |
| InChI | InChI=1S/C24H38N8S/c1-27-33-21-11-12-23(29-18-7-3-2-4-8-18)22(15-21)24(25)30-32(26)20-10-6-14-31(17-20)19-9-5-13-28-16-19/h5,9,11-13,15-16,18,20,24,27,29-30H,2-4,6-8,10,14,17,25-26H2,1H3 |
| InChIKey | PMKSSMJGXWXFNG-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 107.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.69 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|