C13H19N3 — CID 24752137
9-methyl-3-pyridin-3-yl-3,9-diazabicyclo[3.3.1]nonane (PubChem CID 24752137) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 9-methyl-3-pyridin-3-yl-3,9-diazabicyclo[3.3.1]nonane.
| Compound Name | 9-methyl-3-pyridin-3-yl-3,9-diazabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 24752137 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 9-methyl-3-pyridin-3-yl-3,9-diazabicyclo[3.3.1]nonane |
| SMILES | CN1C2CCCC1CN(c1cccnc1)C2 |
| InChI | InChI=1S/C13H19N3/c1-15-12-4-2-5-13(15)10-16(9-12)11-6-3-7-14-8-11/h3,6-8,12-13H,2,4-5,9-10H2,1H3 |
| InChIKey | KHQNUZUXDBHVNC-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |